CAS 115717-83-4 is the registry number for AU-1421. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methyl-2-[(Z)-2-naphthalen-1-ylethenyl]-4-piperidin-1-ylpyridine;hydrochloride (CAS 115717-83-4) is a chemical compound with the molecular formula C23H25ClN2 and a molecular weight of 364.9 g/mol. IUPAC name: 5-methyl-2-[(Z)-2-naphthalen-1-ylethenyl]-4-piperidin-1-ylpyridine;hydrochloride. InChIKey: FIRAEJACZMKMQE-USGGBSEESA-N.
| Molecular formula | C23H25ClN2 |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | 5-methyl-2-[(Z)-2-naphthalen-1-ylethenyl]-4-piperidin-1-ylpyridine;hydrochloride |
| InChIKey | FIRAEJACZMKMQE-USGGBSEESA-N |
| SMILES | CC1=C(C=C(N=C1)/C=C\C2=CC=CC3=CC=CC=C32)N4CCCCC4.Cl |
Computed by PubChem (NCBI)