CAS 1157325-19-3 appears in our catalog under these names: 4-{(1-(2,5-dimethylphenyl)ethyl)amino}-3-methylbenzoic acid, 95%, 4-{(1-(2,5-Dimethylphenyl)ethyl)amino}-3-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-[1-(2,5-dimethylphenyl)ethylamino]-3-methylbenzoic acid (CAS 1157325-19-3) is a chemical compound with the molecular formula C18H21NO2 and a molecular weight of 283.4 g/mol. IUPAC name: 4-[1-(2,5-dimethylphenyl)ethylamino]-3-methylbenzoic acid. InChIKey: QRRAMXGTVIWMAF-UHFFFAOYSA-N.
| Molecular formula | C18H21NO2 |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 4-[1-(2,5-dimethylphenyl)ethylamino]-3-methylbenzoic acid |
| InChIKey | QRRAMXGTVIWMAF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(C)NC2=C(C=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)