CAS 115754-62-6 appears in our catalog under these names: Tributyl(1,3-dioxolan-2-ylmethyl)phosphonium bromide, 95%, Tributyl(1,3–dioxolan–2–ylmethyl)phosphonium Bromide, Tributyl(1,3-dioxolan-2-ylmethyl)phosphonium Bromide, >98.0%(T), ((1,3-Dioxolan-2-yl)methyl)tributylphosphonium bromide 98%, Tributyl(1,3-dioxolan-2-ylmethyl)phosphonium Bromide, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 100g, 250mg, 10g.
Tributyl(1,3-dioxolan-2-ylmethyl)phosphanium bromide (CAS 115754-62-6) is a chemical compound with the molecular formula C16H34BrO2P and a molecular weight of 369.32 g/mol. IUPAC name: tributyl(1,3-dioxolan-2-ylmethyl)phosphanium bromide. InChIKey: SABIECHYMHKXJI-UHFFFAOYSA-M.
| Molecular formula | C16H34BrO2P |
|---|---|
| Molecular weight | 369.32 g/mol |
| IUPAC name | tributyl(1,3-dioxolan-2-ylmethyl)phosphanium bromide |
| InChIKey | SABIECHYMHKXJI-UHFFFAOYSA-M |
| SMILES | CCCC[P+](CCCC)(CCCC)CC1OCCO1.[Br-] |
Computed by PubChem (NCBI)