Products 115754-87-5

CAS 115754-87-5 is the registry number for 2-(2-Furyl)cyclohexanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(furan-2-yl)cyclohexan-1-ol (CAS 115754-87-5) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 2-(furan-2-yl)cyclohexan-1-ol. InChIKey: ZPJHTKRSIFBJMU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O2
Molecular weight166.22 g/mol
IUPAC name2-(furan-2-yl)cyclohexan-1-ol
InChIKeyZPJHTKRSIFBJMU-UHFFFAOYSA-N
SMILESC1CCC(C(C1)C2=CC=CO2)O

Computed by PubChem (NCBI)