Products 1157637-34-7
CAS 1157637-34-7 is the registry number for 3-Bromo-α-methyl-α-(2-methylpropyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3-bromophenyl)-4-methylpentan-2-ol (CAS 1157637-34-7) is a chemical compound with the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. IUPAC name: 2-(3-bromophenyl)-4-methylpentan-2-ol. InChIKey: VXDPZFSODREASN-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4-methylpentan-2-ol |
| InChIKey | VXDPZFSODREASN-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(C1=CC(=CC=C1)Br)O |
Computed by PubChem (NCBI)