Products 115797-49-4

CAS 115797-49-4 is the registry number for 1,6-Hexane-1,1,6,6-d4-diamine, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,1,6,6-tetradeuteriohexane-1,6-diamine (CAS 115797-49-4) is a chemical compound with the molecular formula C6H16N2 and a molecular weight of 120.23 g/mol. IUPAC name: 1,1,6,6-tetradeuteriohexane-1,6-diamine. InChIKey: NAQMVNRVTILPCV-NZLXMSDQSA-N.

Identity
Molecular formulaC6H16N2
Molecular weight120.23 g/mol
IUPAC name1,1,6,6-tetradeuteriohexane-1,6-diamine
InChIKeyNAQMVNRVTILPCV-NZLXMSDQSA-N
SMILES[2H]C([2H])(CCCCC([2H])([2H])N)N

Computed by PubChem (NCBI)