CAS 115797-49-4 is the registry number for 1,6-Hexane-1,1,6,6-d4-diamine, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,1,6,6-tetradeuteriohexane-1,6-diamine (CAS 115797-49-4) is a chemical compound with the molecular formula C6H16N2 and a molecular weight of 120.23 g/mol. IUPAC name: 1,1,6,6-tetradeuteriohexane-1,6-diamine. InChIKey: NAQMVNRVTILPCV-NZLXMSDQSA-N.
| Molecular formula | C6H16N2 |
|---|---|
| Molecular weight | 120.23 g/mol |
| IUPAC name | 1,1,6,6-tetradeuteriohexane-1,6-diamine |
| InChIKey | NAQMVNRVTILPCV-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CCCCC([2H])([2H])N)N |
Computed by PubChem (NCBI)