Products 1158-80-1
CAS 1158-80-1 is the registry number for Spirazidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,12-bis(2-chloroethyl)-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecane dichloride (CAS 1158-80-1) is a chemical compound with the molecular formula C16H32Cl4N4 and a molecular weight of 422.3 g/mol. IUPAC name: 3,12-bis(2-chloroethyl)-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecane dichloride. InChIKey: OYWCUEAJSZQIEE-UHFFFAOYSA-L.
| Molecular formula | C16H32Cl4N4 |
|---|---|
| Molecular weight | 422.3 g/mol |
| IUPAC name | 3,12-bis(2-chloroethyl)-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecane dichloride |
| InChIKey | OYWCUEAJSZQIEE-UHFFFAOYSA-L |
| SMILES | C1C[N+]2(CCN1CCCl)CC[N+]3(CCN(CC3)CCCl)CC2.[Cl-].[Cl-] |
Computed by PubChem (NCBI)