Products 1158231-00-5
CAS 1158231-00-5 is the registry number for D159153. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[[2-fluoro-4-methoxy-3-(3-nitrophenyl)phenyl]methyl]phenyl]urea (CAS 1158231-00-5) is a chemical compound with the molecular formula C21H18FN3O4 and a molecular weight of 395.4 g/mol. IUPAC name: [4-[[2-fluoro-4-methoxy-3-(3-nitrophenyl)phenyl]methyl]phenyl]urea. InChIKey: ANIKIUAKBPWSRA-UHFFFAOYSA-N.
| Molecular formula | C21H18FN3O4 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | [4-[[2-fluoro-4-methoxy-3-(3-nitrophenyl)phenyl]methyl]phenyl]urea |
| InChIKey | ANIKIUAKBPWSRA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CC2=CC=C(C=C2)NC(=O)N)F)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)