CAS 1158376-58-9 is the registry number for 1-(2-Chloro-4-fluorobenzyl)piperazine. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
1-[(2-chloro-4-fluorophenyl)methyl]piperazine;hydrochloride (CAS 1158376-58-9) is a chemical compound with the molecular formula C11H15Cl2FN2 and a molecular weight of 265.15 g/mol. IUPAC name: 1-[(2-chloro-4-fluorophenyl)methyl]piperazine;hydrochloride. InChIKey: NLGNDZRIKQOQNF-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2FN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 1-[(2-chloro-4-fluorophenyl)methyl]piperazine;hydrochloride |
| InChIKey | NLGNDZRIKQOQNF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C=C(C=C2)F)Cl.Cl |
Computed by PubChem (NCBI)