CAS 1158412-19-1 is the registry number for 1-(2-Thienylmethyl)piperidin-3-amine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-(thiophen-2-ylmethyl)piperidin-3-amine;dihydrochloride (CAS 1158412-19-1) is a chemical compound with the molecular formula C10H18Cl2N2S and a molecular weight of 269.23 g/mol. IUPAC name: 1-(thiophen-2-ylmethyl)piperidin-3-amine;dihydrochloride. InChIKey: SHNYCLXHOMYBRF-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N2S |
|---|---|
| Molecular weight | 269.23 g/mol |
| IUPAC name | 1-(thiophen-2-ylmethyl)piperidin-3-amine;dihydrochloride |
| InChIKey | SHNYCLXHOMYBRF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CS2)N.Cl.Cl |
Computed by PubChem (NCBI)