CAS 1158464-98-2 is the registry number for Sodium 2-(ethoxycarbonyl)-1-oxo-1H-inden-3-olate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Sodium 2-ethoxycarbonyl-3-oxoinden-1-olate (CAS 1158464-98-2) is a chemical compound with the molecular formula C12H9NaO4 and a molecular weight of 240.19 g/mol. IUPAC name: sodium 2-ethoxycarbonyl-3-oxoinden-1-olate. InChIKey: NQKHSPTYCZGXAV-UHFFFAOYSA-M.
| Molecular formula | C12H9NaO4 |
|---|---|
| Molecular weight | 240.19 g/mol |
| IUPAC name | sodium 2-ethoxycarbonyl-3-oxoinden-1-olate |
| InChIKey | NQKHSPTYCZGXAV-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2C1=O)[O-].[Na+] |
Computed by PubChem (NCBI)