CAS 1158549-80-4 appears in our catalog under these names: [3-(2H-1,2,3-Benzotriazol-2-yl)-2-methoxy-5-methylphenyl]amine hydrochloride, 95%, (3-(2H-1,2,3-BEnzotriazol-2-yl)-2-methoxy-5-methylphenyl)amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(benzotriazol-2-yl)-2-methoxy-5-methylaniline;hydrochloride (CAS 1158549-80-4) is a chemical compound with the molecular formula C14H15ClN4O and a molecular weight of 290.75 g/mol. IUPAC name: 3-(benzotriazol-2-yl)-2-methoxy-5-methylaniline;hydrochloride. InChIKey: CQTWFXQUSPERQR-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN4O |
|---|---|
| Molecular weight | 290.75 g/mol |
| IUPAC name | 3-(benzotriazol-2-yl)-2-methoxy-5-methylaniline;hydrochloride |
| InChIKey | CQTWFXQUSPERQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)N2N=C3C=CC=CC3=N2)OC)N.Cl |
Computed by PubChem (NCBI)