CAS 1158607-76-1 appears in our catalog under these names: 1-Benzoylpiperidin-3-amine hydrochloride, 1-Benzoyl-3-piperidinamine hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 100mg, 250mg.
(3-aminopiperidin-1-yl)-phenylmethanone;hydrochloride (CAS 1158607-76-1) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: (3-aminopiperidin-1-yl)-phenylmethanone;hydrochloride. InChIKey: OOKGNGIDKDJFSC-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | (3-aminopiperidin-1-yl)-phenylmethanone;hydrochloride |
| InChIKey | OOKGNGIDKDJFSC-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)