CAS 1158631-16-3 is the registry number for 5-Chloro-2-(piperazin-1-yl)benzo(d)oxazole dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-2-piperazin-1-yl-1,3-benzoxazole;dihydrochloride (CAS 1158631-16-3) is a chemical compound with the molecular formula C11H14Cl3N3O and a molecular weight of 310.6 g/mol. IUPAC name: 5-chloro-2-piperazin-1-yl-1,3-benzoxazole;dihydrochloride. InChIKey: CLBAFEMXTWDJBI-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3N3O |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 5-chloro-2-piperazin-1-yl-1,3-benzoxazole;dihydrochloride |
| InChIKey | CLBAFEMXTWDJBI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(O2)C=CC(=C3)Cl.Cl.Cl |
Computed by PubChem (NCBI)