CAS 1158748-26-5 is the registry number for (4-Bromo-1H-indol-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-bromo-1H-indol-3-yl)methanol (CAS 1158748-26-5) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: (4-bromo-1H-indol-3-yl)methanol. InChIKey: ALSCHTQXMJNCJS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | (4-bromo-1H-indol-3-yl)methanol |
| InChIKey | ALSCHTQXMJNCJS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)CO |
Computed by PubChem (NCBI)