Products 1158759-57-9
CAS 1158759-57-9 is the registry number for 1-Boc-3-amino-3-((Boc-amino)methyl)azetidine, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 3-amino-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidine-1-carboxylate (CAS 1158759-57-9) is a chemical compound with the molecular formula C14H27N3O4 and a molecular weight of 301.38 g/mol. IUPAC name: tert-butyl 3-amino-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidine-1-carboxylate. InChIKey: DWYGECNFNSFPEE-UHFFFAOYSA-N.
| Molecular formula | C14H27N3O4 |
|---|---|
| Molecular weight | 301.38 g/mol |
| IUPAC name | tert-butyl 3-amino-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidine-1-carboxylate |
| InChIKey | DWYGECNFNSFPEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CN(C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)