Products 1158765-77-5
CAS 1158765-77-5 is the registry number for tert-Butyl 3-(4-bromo-3-fluorophenyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(4-bromo-3-fluorophenyl)pyrrolidine-1-carboxylate (CAS 1158765-77-5) is a chemical compound with the molecular formula C15H19BrFNO2 and a molecular weight of 344.22 g/mol. IUPAC name: tert-butyl 3-(4-bromo-3-fluorophenyl)pyrrolidine-1-carboxylate. InChIKey: TXAKRFQHJKSWAA-UHFFFAOYSA-N.
| Molecular formula | C15H19BrFNO2 |
|---|---|
| Molecular weight | 344.22 g/mol |
| IUPAC name | tert-butyl 3-(4-bromo-3-fluorophenyl)pyrrolidine-1-carboxylate |
| InChIKey | TXAKRFQHJKSWAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)