CAS 1158794-11-6 appears in our catalog under these names: 1-(Benzo(d)thiazol-2-yl)ethanamine hydrochloride, 98%, 1-(1,3-Benzothiazol-2-yl)ethan-1-amine hydrochloride, 1-(1,3-BENZOTHIAZOL-2-YL)ETHANAMINE HYDROCHLORIDE, 98%, 98%, 1-(Benzo[d]thiazol-2-yl)ethanamine hydrochloride, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 100mg, 10g, 1g.
1-(1,3-benzothiazol-2-yl)ethanamine;hydrochloride (CAS 1158794-11-6) is a chemical compound with the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)ethanamine;hydrochloride. InChIKey: VQFNLUOAQQCKBK-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2S |
|---|---|
| Molecular weight | 214.72 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)ethanamine;hydrochloride |
| InChIKey | VQFNLUOAQQCKBK-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=CC=CC=C2S1)N.Cl |
Computed by PubChem (NCBI)