CAS 1158844-76-8 appears in our catalog under these names: 2,9,9–triphenyl–9H–fluorene, 2,9,9-Triphenyl-9H-fluorene, 96%, 96%, 2,9,9-Triphenyl-9H-fluorene, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
2,9,9-triphenylfluorene (CAS 1158844-76-8) is a chemical compound with the molecular formula C31H22 and a molecular weight of 394.5 g/mol. IUPAC name: 2,9,9-triphenylfluorene. InChIKey: GOENSWLRVPAREA-UHFFFAOYSA-N.
| Molecular formula | C31H22 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 2,9,9-triphenylfluorene |
| InChIKey | GOENSWLRVPAREA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)C4=CC=CC=C4C3(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)