CAS 115897-54-6 appears in our catalog under these names: Itraconazole Impurity 39, Itraconazole Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate (CAS 115897-54-6) is a chemical compound with the molecular formula C14H15Cl2N3O5S and a molecular weight of 408.3 g/mol. IUPAC name: [2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate. InChIKey: QIMASXGTWQEFGS-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O5S |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | [2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
| InChIKey | QIMASXGTWQEFGS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1COC(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)