CAS 1158970-76-3 is the registry number for Lesinurad Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5-thione (CAS 1158970-76-3) is a chemical compound with the molecular formula C15H12BrN3S and a molecular weight of 346.2 g/mol. IUPAC name: 3-bromo-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5-thione. InChIKey: DMAJCLCFJTWPDG-UHFFFAOYSA-N.
| Molecular formula | C15H12BrN3S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 3-bromo-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
| InChIKey | DMAJCLCFJTWPDG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N4C(=S)NN=C4Br |
Computed by PubChem (NCBI)