CAS 1158984-94-1 appears in our catalog under these names: tert-Butyl 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)-1h-pyrrole-1-carboxylate, 95%, N-Boc-pyrrole-2-boronic acid MIDA ester, 95%, N–Boc–pyrrole–2–boronic acid MIDA ester, N-BOC-PYRROLE-2-BORONIC ACID MIDA ESTER&. Offered by: Combi-blocks, AmBeed, GLPBio, Sigma-Aldrich. Available pack sizes: 100g, 5g, 25g, 1g.
Tert-butyl 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)pyrrole-1-carboxylate (CAS 1158984-94-1) is a chemical compound with the molecular formula C14H19BN2O6 and a molecular weight of 322.12 g/mol. IUPAC name: tert-butyl 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)pyrrole-1-carboxylate. InChIKey: HASMDYSWFBSATG-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O6 |
|---|---|
| Molecular weight | 322.12 g/mol |
| IUPAC name | tert-butyl 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)pyrrole-1-carboxylate |
| InChIKey | HASMDYSWFBSATG-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=CN2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)