CAS 115903-57-6 appears in our catalog under these names: 5-(5-Chloro-2-thienyl)-1,3,4-oxadiazole-2-thiol, 95%, 5-(5-Chloro-2-thienyl)-1,3,4-oxadiazole-2-thiol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-(5-chlorothiophen-2-yl)-3H-1,3,4-oxadiazole-2-thione (CAS 115903-57-6) is a chemical compound with the molecular formula C6H3ClN2OS2 and a molecular weight of 218.7 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: WWBZXJCBUXONMV-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2OS2 |
|---|---|
| Molecular weight | 218.7 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | WWBZXJCBUXONMV-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)