CAS 1159195-70-6 appears in our catalog under these names: Zafirlukast Impurity 3, Zafirlukast p-Tolyl Isomer, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
Cyclopentyl N-[3-[[2-methoxy-4-[(4-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-methylindol-5-yl]carbamate (CAS 1159195-70-6) is a chemical compound with the molecular formula C31H33N3O6S and a molecular weight of 575.7 g/mol. IUPAC name: cyclopentyl N-[3-[[2-methoxy-4-[(4-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-methylindol-5-yl]carbamate. InChIKey: HOOQJZTUMKGZMP-UHFFFAOYSA-N.
| Molecular formula | C31H33N3O6S |
|---|---|
| Molecular weight | 575.7 g/mol |
| IUPAC name | cyclopentyl N-[3-[[2-methoxy-4-[(4-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-methylindol-5-yl]carbamate |
| InChIKey | HOOQJZTUMKGZMP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)C2=CC(=C(C=C2)CC3=CN(C4=C3C=C(C=C4)NC(=O)OC5CCCC5)C)OC |
Computed by PubChem (NCBI)