CAS 1159208-89-5 is the registry number for N-Chloromethyl Hydroxychloroquine. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
Chloromethyl-[4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethyl-(2-hydroxyethyl)azanium iodide (CAS 1159208-89-5) is a chemical compound with the molecular formula C19H28Cl2IN3O and a molecular weight of 512.3 g/mol. IUPAC name: chloromethyl-[4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethyl-(2-hydroxyethyl)azanium iodide. InChIKey: FLBSNIZKMYBVTM-UHFFFAOYSA-M.
| Molecular formula | C19H28Cl2IN3O |
|---|---|
| Molecular weight | 512.3 g/mol |
| IUPAC name | chloromethyl-[4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethyl-(2-hydroxyethyl)azanium iodide |
| InChIKey | FLBSNIZKMYBVTM-UHFFFAOYSA-M |
| SMILES | CC[N+](CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)(CCO)CCl.[I-] |
Computed by PubChem (NCBI)