CAS 115931-01-6 appears in our catalog under these names: Zaleplon Impurity 8, Zaleplon Impurity 15, N-(3-(3-Cyanopyrazolo(1,5-a)pyrimidin-7-yl)phenyl)acetamide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]acetamide (CAS 115931-01-6) is a chemical compound with the molecular formula C15H11N5O and a molecular weight of 277.28 g/mol. IUPAC name: N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]acetamide. InChIKey: HGCZTXQJFDPOKK-UHFFFAOYSA-N.
| Molecular formula | C15H11N5O |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]acetamide |
| InChIKey | HGCZTXQJFDPOKK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)C2=CC=NC3=C(C=NN23)C#N |
Computed by PubChem (NCBI)