CAS 115932-13-3 appears in our catalog under these names: Zaleplon Impurity 16, Zaleplon Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-methylacetamide (CAS 115932-13-3) is a chemical compound with the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. IUPAC name: N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-methylacetamide. InChIKey: GGZBVBSDVPJFEF-UHFFFAOYSA-N.
| Molecular formula | C16H13N5O |
|---|---|
| Molecular weight | 291.31 g/mol |
| IUPAC name | N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-methylacetamide |
| InChIKey | GGZBVBSDVPJFEF-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1=CC=CC(=C1)C2=CC=NC3=C(C=NN23)C#N |
Computed by PubChem (NCBI)