CAS 1159517-02-8 is the registry number for 2-(Benzo[d]oxazol-2-yl)-5-bromophenol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-benzoxazol-2-yl)-5-bromophenol (CAS 1159517-02-8) is a chemical compound with the molecular formula C13H8BrNO2 and a molecular weight of 290.11 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-yl)-5-bromophenol. InChIKey: IKSMWVIRNGZJQQ-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNO2 |
|---|---|
| Molecular weight | 290.11 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-yl)-5-bromophenol |
| InChIKey | IKSMWVIRNGZJQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=C(C=C(C=C3)Br)O |
Computed by PubChem (NCBI)