CAS 1159576-98-3 appears in our catalog under these names: CAY10606, 5-LOX-IN-6. Offered by: Chemat Brand, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 5 mg, 1 mg.
Ethyl 2-[(3-chlorophenyl)methyl]-5-hydroxy-1H-benzo[g]indole-3-carboxylate (CAS 1159576-98-3) is a chemical compound with the molecular formula C22H18ClNO3 and a molecular weight of 379.8 g/mol. IUPAC name: ethyl 2-[(3-chlorophenyl)methyl]-5-hydroxy-1H-benzo[g]indole-3-carboxylate. InChIKey: UNDGVXYIMIZWAS-UHFFFAOYSA-N.
| Molecular formula | C22H18ClNO3 |
|---|---|
| Molecular weight | 379.8 g/mol |
| IUPAC name | ethyl 2-[(3-chlorophenyl)methyl]-5-hydroxy-1H-benzo[g]indole-3-carboxylate |
| InChIKey | UNDGVXYIMIZWAS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C1C=C(C3=CC=CC=C32)O)CC4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)