CAS 1159595-96-6 is the registry number for 4'–(2H–Tetrazol–5–yl)–(1,1'–biphenyl)–3,5–dicarboxylicacid. Offered by: GLPBio. Available pack sizes: 1g.
5-[4-(2H-tetrazol-5-yl)phenyl]benzene-1,3-dicarboxylic acid (CAS 1159595-96-6) is a chemical compound with the molecular formula C15H10N4O4 and a molecular weight of 310.26 g/mol. IUPAC name: 5-[4-(2H-tetrazol-5-yl)phenyl]benzene-1,3-dicarboxylic acid. InChIKey: PBWAEDNWIIGYCB-UHFFFAOYSA-N.
| Molecular formula | C15H10N4O4 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | 5-[4-(2H-tetrazol-5-yl)phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | PBWAEDNWIIGYCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=NNN=N3 |
Computed by PubChem (NCBI)