Products 1159596-05-0
CAS 1159596-05-0 appears in our catalog under these names: 5'-(2H-Tetrazol-5-yl)-[1,1':3',1''-terphenyl]-4,4'-dicarboxylic acid, 95%, 3'-(4-carboxyphenyl)-5'-(1H-1,2,3,4-tetrazol-5-yl)-[1,1'-biphenyl]-4-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-carboxyphenyl)-2-phenyl-6-(2H-tetrazol-5-yl)benzoic acid (CAS 1159596-05-0) is a chemical compound with the molecular formula C21H14N4O4 and a molecular weight of 386.4 g/mol. IUPAC name: 4-(4-carboxyphenyl)-2-phenyl-6-(2H-tetrazol-5-yl)benzoic acid. InChIKey: RHKSHLMNQNJBIS-UHFFFAOYSA-N.
| Molecular formula | C21H14N4O4 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)-2-phenyl-6-(2H-tetrazol-5-yl)benzoic acid |
| InChIKey | RHKSHLMNQNJBIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC(=C2)C3=CC=C(C=C3)C(=O)O)C4=NNN=N4)C(=O)O |
Computed by PubChem (NCBI)