Products 1159816-53-1
CAS 1159816-53-1 is the registry number for 2-Bromo-6-(4-methyl-1H-pyrazol-1-yl)pyridine, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
2-bromo-6-(4-methylpyrazol-1-yl)pyridine (CAS 1159816-53-1) is a chemical compound with the molecular formula C9H8BrN3 and a molecular weight of 238.08 g/mol. IUPAC name: 2-bromo-6-(4-methylpyrazol-1-yl)pyridine. InChIKey: DCOKJKAIUKIIGQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3 |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 2-bromo-6-(4-methylpyrazol-1-yl)pyridine |
| InChIKey | DCOKJKAIUKIIGQ-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1)C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)