CAS 1159825-39-4 is the registry number for 1-N-Boc-4-(4-bromo-2-chlorophenoxy)piperidine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 4-(4-bromo-2-chlorophenoxy)piperidine-1-carboxylate (CAS 1159825-39-4) is a chemical compound with the molecular formula C16H21BrClNO3 and a molecular weight of 390.7 g/mol. IUPAC name: tert-butyl 4-(4-bromo-2-chlorophenoxy)piperidine-1-carboxylate. InChIKey: HVQNGOMNKHVTBV-UHFFFAOYSA-N.
| Molecular formula | C16H21BrClNO3 |
|---|---|
| Molecular weight | 390.7 g/mol |
| IUPAC name | tert-butyl 4-(4-bromo-2-chlorophenoxy)piperidine-1-carboxylate |
| InChIKey | HVQNGOMNKHVTBV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)OC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)