Products 1159835-30-9
CAS 1159835-30-9 appears in our catalog under these names: 4-(4-Bromophenoxy)-1-(tert-butoxycarbonyl)piperidine-4-carboxylic acid, 95%, 95%, 4-(4-Bromophenoxy)-1-(tert-butoxycarbonyl)piperidine-4-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-bromophenoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1159835-30-9) is a chemical compound with the molecular formula C17H22BrNO5 and a molecular weight of 400.3 g/mol. IUPAC name: 4-(4-bromophenoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: FAWVVCZACZYUIL-UHFFFAOYSA-N.
| Molecular formula | C17H22BrNO5 |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 4-(4-bromophenoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | FAWVVCZACZYUIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)