Products 1159908-44-7
CAS 1159908-44-7 appears in our catalog under these names: Arachidonoyl Glycine–d8, Arachidonoyl glycine-d8, N-Arachidonylglycine-d8, 98.1%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 100μg, 5mg, 500μg, 10mg, 25mg, 50mg, 1 mg (2.71 mM * 1 mL in Ethanol).
2-[[(5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoyl]amino]acetic acid (CAS 1159908-44-7) is a chemical compound with the molecular formula C22H35NO3 and a molecular weight of 369.6 g/mol. IUPAC name: 2-[[(5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoyl]amino]acetic acid. InChIKey: YLEARPUNMCCKMP-FBFLGLDDSA-N.
| Molecular formula | C22H35NO3 |
|---|---|
| Molecular weight | 369.6 g/mol |
| IUPAC name | 2-[[(5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoyl]amino]acetic acid |
| InChIKey | YLEARPUNMCCKMP-FBFLGLDDSA-N |
| SMILES | [2H]/C(=C(\[2H])/C/C(=C(/[2H])\C/C(=C(/[2H])\C/C(=C(/[2H])\CCCC(=O)NCC(=O)O)/[2H])/[2H])/[2H])/CCCCC |
Computed by PubChem (NCBI)