Products 1159908-45-8

CAS 1159908-45-8 appears in our catalog under these names: Palmitoyl Ethanolamide-d4, Palmitoylethanolamide-d4, 99.9%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 100 μg (3.29 mM * 100 μL in Ethanol).

Structural formula: {0} (CAS {1})

7,7,8,8-tetradeuterio-N-(2-hydroxyethyl)hexadecanamide (CAS 1159908-45-8) is a chemical compound with the molecular formula C18H37NO2 and a molecular weight of 303.5 g/mol. IUPAC name: 7,7,8,8-tetradeuterio-N-(2-hydroxyethyl)hexadecanamide. InChIKey: HXYVTAGFYLMHSO-YQUBHJMPSA-N.

Identity
Molecular formulaC18H37NO2
Molecular weight303.5 g/mol
IUPAC name7,7,8,8-tetradeuterio-N-(2-hydroxyethyl)hexadecanamide
InChIKeyHXYVTAGFYLMHSO-YQUBHJMPSA-N
SMILES[2H]C([2H])(CCCCCCCC)C([2H])([2H])CCCCCC(=O)NCCO

Computed by PubChem (NCBI)