CAS 1159908-45-8 appears in our catalog under these names: Palmitoyl Ethanolamide-d4, Palmitoylethanolamide-d4, 99.9%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 100 μg (3.29 mM * 100 μL in Ethanol).
7,7,8,8-tetradeuterio-N-(2-hydroxyethyl)hexadecanamide (CAS 1159908-45-8) is a chemical compound with the molecular formula C18H37NO2 and a molecular weight of 303.5 g/mol. IUPAC name: 7,7,8,8-tetradeuterio-N-(2-hydroxyethyl)hexadecanamide. InChIKey: HXYVTAGFYLMHSO-YQUBHJMPSA-N.
| Molecular formula | C18H37NO2 |
|---|---|
| Molecular weight | 303.5 g/mol |
| IUPAC name | 7,7,8,8-tetradeuterio-N-(2-hydroxyethyl)hexadecanamide |
| InChIKey | HXYVTAGFYLMHSO-YQUBHJMPSA-N |
| SMILES | [2H]C([2H])(CCCCCCCC)C([2H])([2H])CCCCCC(=O)NCCO |
Computed by PubChem (NCBI)