CAS 1159976-77-8 is the registry number for 5–(4–Bromophenyl)–4–(fluoromethyl)–2,3–dihydro–1,3–oxazol–2–one. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
5-(4-bromophenyl)-4-(fluoromethyl)-3H-1,3-oxazol-2-one (CAS 1159976-77-8) is a chemical compound with the molecular formula C10H7BrFNO2 and a molecular weight of 272.07 g/mol. IUPAC name: 5-(4-bromophenyl)-4-(fluoromethyl)-3H-1,3-oxazol-2-one. InChIKey: OVZQWKHWFGOZSF-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFNO2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)-4-(fluoromethyl)-3H-1,3-oxazol-2-one |
| InChIKey | OVZQWKHWFGOZSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(NC(=O)O2)CF)Br |
Computed by PubChem (NCBI)