Products 1159977-24-8
CAS 1159977-24-8 appears in our catalog under these names: 1,3,6,11-Tetrahydroxy-10-methoxytetracene-5,12-dione, 98%, Doxorubicin Impurity 16, Doxorubicin Impurity 1, Xanthone Impurity 13, 7,8-Desacetyl-9,10-dehydro Daunorubicinone (~90%) (Doxorubicin Impurity). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
1,3,6,11-tetrahydroxy-10-methoxytetracene-5,12-dione (CAS 1159977-24-8) is a chemical compound with the molecular formula C19H12O7 and a molecular weight of 352.3 g/mol. IUPAC name: 1,3,6,11-tetrahydroxy-10-methoxytetracene-5,12-dione. InChIKey: UWWVMUSJXQWJOE-UHFFFAOYSA-N.
| Molecular formula | C19H12O7 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 1,3,6,11-tetrahydroxy-10-methoxytetracene-5,12-dione |
| InChIKey | UWWVMUSJXQWJOE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=C3C(=C2O)C(=O)C4=C(C3=O)C(=CC(=C4)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Doxorubicin Impurity 1, 7,8-Desacetyl-9,10-dehydro Daunorubicinone, 1,3,6,11-tetrahydroxy-10-methoxytetracene-5,12-dione, Daunorubicin Impurity 1, 6,8,10,11-Tetrahydroxy-1-methoxy-5,12-naphthacenedione, (Doxorubicin Impurity), 7,8-Desacetyl-9,10-dehydro Daunorubicinone (~90%), 5,12-Naphthacenedione, 6,8,10,11-tetrahydroxy-1-methoxy-