CAS 1159977-27-1 appears in our catalog under these names: 2-(((4-Chloro-3-methylpyridin-2-yl)methyl)sulfonyl)-1H-benzo[d]imidazole, 98%, Rabeprazole sodium Impurity Q, Rabeprazole Impurity 25, 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-[(4-chloro-3-methyl-2-pyridinyl)methylsulfonyl]-1H-benzimidazole (CAS 1159977-27-1) is a chemical compound with the molecular formula C14H12ClN3O2S and a molecular weight of 321.8 g/mol. IUPAC name: 2-[(4-chloro-3-methyl-2-pyridinyl)methylsulfonyl]-1H-benzimidazole. InChIKey: ACKATQAAEKWYKV-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O2S |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 2-[(4-chloro-3-methyl-2-pyridinyl)methylsulfonyl]-1H-benzimidazole |
| InChIKey | ACKATQAAEKWYKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)Cl |
Computed by PubChem (NCBI)