Products 1159977-31-7
CAS 1159977-31-7 appears in our catalog under these names: Darifenacin Cyano Impurity, Darifenacin Impurity 5, 2,2-Diphenyl 2-(1-Boc-3-pyrrolidinyl)acetonitrile. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Tert-butyl 3-[cyano(diphenyl)methyl]pyrrolidine-1-carboxylate (CAS 1159977-31-7) is a chemical compound with the molecular formula C23H26N2O2 and a molecular weight of 362.5 g/mol. IUPAC name: tert-butyl 3-[cyano(diphenyl)methyl]pyrrolidine-1-carboxylate. InChIKey: VPWJEZHVOGYEQA-UHFFFAOYSA-N.
| Molecular formula | C23H26N2O2 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | tert-butyl 3-[cyano(diphenyl)methyl]pyrrolidine-1-carboxylate |
| InChIKey | VPWJEZHVOGYEQA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C(C#N)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)