Products 116-49-4
CAS 116-49-4 is the registry number for Glycobiarsol. Offered by: MedChemExpress. Available pack sizes: Get quote.
Bismuth;hydroxy-[4-[(2-hydroxyacetyl)amino]phenyl]arsinate;oxygen(2-) (CAS 116-49-4) is a chemical compound with the molecular formula C8H9AsBiNO6 and a molecular weight of 499.06 g/mol. IUPAC name: bismuth;hydroxy-[4-[(2-hydroxyacetyl)amino]phenyl]arsinate;oxygen(2-). InChIKey: UPCVPFKBUJAADX-UHFFFAOYSA-M.
| Molecular formula | C8H9AsBiNO6 |
|---|---|
| Molecular weight | 499.06 g/mol |
| IUPAC name | bismuth;hydroxy-[4-[(2-hydroxyacetyl)amino]phenyl]arsinate;oxygen(2-) |
| InChIKey | UPCVPFKBUJAADX-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1NC(=O)CO)[As](=O)(O)[O-].[O-2].[Bi+3] |
Computed by PubChem (NCBI)