CAS 116-52-9 appears in our catalog under these names: Dicloralurea/ 98%, Dicloralurea. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 100mg, 200mg, 5 mg.
1,3-bis(2,2,2-trichloro-1-hydroxyethyl)urea (CAS 116-52-9) is a chemical compound with the molecular formula C5H6Cl6N2O3 and a molecular weight of 354.8 g/mol. IUPAC name: 1,3-bis(2,2,2-trichloro-1-hydroxyethyl)urea. InChIKey: PPJXIHLNYDVTDI-UHFFFAOYSA-N.
| Molecular formula | C5H6Cl6N2O3 |
|---|---|
| Molecular weight | 354.8 g/mol |
| IUPAC name | 1,3-bis(2,2,2-trichloro-1-hydroxyethyl)urea |
| InChIKey | PPJXIHLNYDVTDI-UHFFFAOYSA-N |
| SMILES | C(C(Cl)(Cl)Cl)(NC(=O)NC(C(Cl)(Cl)Cl)O)O |
Computed by PubChem (NCBI)