CAS 116-75-6 appears in our catalog under these names: Solvent blue 104, 95%, Solvent Blue 104, 1,4–bis(mesitylamino)anthraquinone, Solvent Blue 104 98%, 1,4-Bis(mesitylamino)anthraquinone. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1g, 10g, 50g, 5g, 100g, 25g, 500g.
1,4-bis(2,4,6-trimethylanilino)anthracene-9,10-dione (CAS 116-75-6) is a chemical compound with the molecular formula C32H30N2O2 and a molecular weight of 474.6 g/mol. IUPAC name: 1,4-bis(2,4,6-trimethylanilino)anthracene-9,10-dione. InChIKey: DMDRBXCDTZRMHZ-UHFFFAOYSA-N.
| Molecular formula | C32H30N2O2 |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | 1,4-bis(2,4,6-trimethylanilino)anthracene-9,10-dione |
| InChIKey | DMDRBXCDTZRMHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=C3C(=C(C=C2)NC4=C(C=C(C=C4C)C)C)C(=O)C5=CC=CC=C5C3=O)C |
Computed by PubChem (NCBI)