CAS 1160058-86-5 appears in our catalog under these names: 4-([4-(Trifluoromethyl)pyrimidin-2-yl]oxy)benzenesulfonyl chloride, 95%, 4-{[4-(Trifluoromethyl)pyrimidin-2-yl]oxy}benzenesulfonyl chloride, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 250mg, 1g.
4-[4-(trifluoromethyl)pyrimidin-2-yl]oxybenzenesulfonyl chloride (CAS 1160058-86-5) is a chemical compound with the molecular formula C11H6ClF3N2O3S and a molecular weight of 338.69 g/mol. IUPAC name: 4-[4-(trifluoromethyl)pyrimidin-2-yl]oxybenzenesulfonyl chloride. InChIKey: SMDWXDCIMUGFNP-UHFFFAOYSA-N.
| Molecular formula | C11H6ClF3N2O3S |
|---|---|
| Molecular weight | 338.69 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)pyrimidin-2-yl]oxybenzenesulfonyl chloride |
| InChIKey | SMDWXDCIMUGFNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=NC=CC(=N2)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)