Products 1160060-61-6

CAS 1160060-61-6 is the registry number for 1-(Pyridin-3-yl)-9H-pyrido(3,4-b)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-pyridin-3-yl-9H-pyrido[3,4-b]indole (CAS 1160060-61-6) is a chemical compound with the molecular formula C16H11N3 and a molecular weight of 245.28 g/mol. IUPAC name: 1-pyridin-3-yl-9H-pyrido[3,4-b]indole. InChIKey: SQKVBMCGMZWQHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11N3
Molecular weight245.28 g/mol
IUPAC name1-pyridin-3-yl-9H-pyrido[3,4-b]indole
InChIKeySQKVBMCGMZWQHQ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C4=CN=CC=C4

Computed by PubChem (NCBI)