CAS 1160247-60-8 is the registry number for tert–Butyl 5–methylspiro(indene–1,4'–piperidine)–1'–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl 5-methylspiro[indene-1,4'-piperidine]-1'-carboxylate (CAS 1160247-60-8) is a chemical compound with the molecular formula C19H25NO2 and a molecular weight of 299.4 g/mol. IUPAC name: tert-butyl 5-methylspiro[indene-1,4'-piperidine]-1'-carboxylate. InChIKey: KRZLIHJCCINWTR-UHFFFAOYSA-N.
| Molecular formula | C19H25NO2 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | tert-butyl 5-methylspiro[indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | KRZLIHJCCINWTR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3(CCN(CC3)C(=O)OC(C)(C)C)C=C2 |
Computed by PubChem (NCBI)