Products 1160248-80-5

CAS 1160248-80-5 is the registry number for 4,5-Dimethylthiophene-3-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4,5-dimethylthiophene-3-carbonyl chloride (CAS 1160248-80-5) is a chemical compound with the molecular formula C7H7ClOS and a molecular weight of 174.65 g/mol. IUPAC name: 4,5-dimethylthiophene-3-carbonyl chloride. InChIKey: BABKQMLNHKKSHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClOS
Molecular weight174.65 g/mol
IUPAC name4,5-dimethylthiophene-3-carbonyl chloride
InChIKeyBABKQMLNHKKSHQ-UHFFFAOYSA-N
SMILESCC1=C(SC=C1C(=O)Cl)C

Computed by PubChem (NCBI)