Products 1160248-84-9

CAS 1160248-84-9 is the registry number for 5-Propylthiophene-3-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-propylthiophene-3-carbonyl chloride (CAS 1160248-84-9) is a chemical compound with the molecular formula C8H9ClOS and a molecular weight of 188.67 g/mol. IUPAC name: 5-propylthiophene-3-carbonyl chloride. InChIKey: RTSDAWMEIVUMFX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClOS
Molecular weight188.67 g/mol
IUPAC name5-propylthiophene-3-carbonyl chloride
InChIKeyRTSDAWMEIVUMFX-UHFFFAOYSA-N
SMILESCCCC1=CC(=CS1)C(=O)Cl

Computed by PubChem (NCBI)