CAS 1160250-40-7 is the registry number for 3-Bromo-4,5-diethoxybenzoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-bromo-4,5-diethoxybenzoyl chloride (CAS 1160250-40-7) is a chemical compound with the molecular formula C11H12BrClO3 and a molecular weight of 307.57 g/mol. IUPAC name: 3-bromo-4,5-diethoxybenzoyl chloride. InChIKey: GJSGSVVDMSRSQX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO3 |
|---|---|
| Molecular weight | 307.57 g/mol |
| IUPAC name | 3-bromo-4,5-diethoxybenzoyl chloride |
| InChIKey | GJSGSVVDMSRSQX-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C(=O)Cl)Br)OCC |
Computed by PubChem (NCBI)