Products 1160253-17-7

CAS 1160253-17-7 appears in our catalog under these names: 6-Bromo-2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride, 95%, 6-Bromo-2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-bromo-2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride (CAS 1160253-17-7) is a chemical compound with the molecular formula C18H13BrClNO and a molecular weight of 374.7 g/mol. IUPAC name: 6-bromo-2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride. InChIKey: IGDVPNKDDHJMRN-UHFFFAOYSA-N.

Identity
Molecular formulaC18H13BrClNO
Molecular weight374.7 g/mol
IUPAC name6-bromo-2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride
InChIKeyIGDVPNKDDHJMRN-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)Cl)C

Computed by PubChem (NCBI)